|
|
| | 2-Thiomethylpyrimidine-4-carboxylic acid Basic information |
| | 2-Thiomethylpyrimidine-4-carboxylic acid Chemical Properties |
| Melting point | 208-210 °C (decomp) | | Boiling point | 378.4±15.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Crystalline Powder | | pka | 2.66±0.10(Predicted) | | color | White to pale yellow | | InChI | InChI=1S/C6H6N2O2S/c1-11-6-7-3-2-4(8-6)5(9)10/h2-3H,1H3,(H,9,10) | | InChIKey | IAGNLKODEFUQDV-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=CC(C(O)=O)=N1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | HS Code | 29335995 |
| | 2-Thiomethylpyrimidine-4-carboxylic acid Usage And Synthesis |
| Uses | 2-Thiomethylpyrimidine-4-carboxylic Acid was a useful reagent in development of orally bioavailable bicyclic pyrazolones as inhibitors of tumor necrosis factor. | | Synthesis | 2-Thiomethylpyrimidine-4-carboxylic acid can be prepared by first reacting mucobromic acid and 2-methyl-isothiourea to obtain 5-bromo-2-methylthio-pyrimidine-4-carboxylic acid, and then 2-methylthio-4-pyrimidinecarboxylic acid can be obtained by debromination. |
| | 2-Thiomethylpyrimidine-4-carboxylic acid Preparation Products And Raw materials |
|