Chrysin 6-C-glucoside 8-C-arabinoside manufacturers
|
| | Chrysin 6-C-glucoside 8-C-arabinoside Basic information |
| Product Name: | Chrysin 6-C-glucoside 8-C-arabinoside | | Synonyms: | Chrysin 6-C-glucoside 8-C-arabinoside;4H-1-Benzopyran-4-one, 8-α-L-arabinopyranosyl-6-β-D-glucopyranosyl-5,7-dihydroxy-2-phenyl-;Chrysin 6-C-β-D-glucopyranosyl 8-C-α-L-arabinopyranoside;Chrysin 6-C-glucoside 8-C-arabinoside, 10 mM in DMSO | | CAS: | 185145-34-0 | | MF: | C26H28O13 | | MW: | 548.49 | | EINECS: | | | Product Categories: | | | Mol File: | 185145-34-0.mol |  |
| | Chrysin 6-C-glucoside 8-C-arabinoside Chemical Properties |
| Boiling point | 888.8±65.0 °C(Predicted) | | density | 1.708±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 5.68±0.40(Predicted) | | color | Off-white to light yellow | | InChIKey | ZGVGUTOTMNVHSX-KXXGJUJGNA-N | | SMILES | C1(C2=CC=CC=C2)OC2=C(C(O)=C(C3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3)C(O)=C2[C@H]2[C@H](O)[C@@H](O)[C@@H](O)CO2)C(=O)C=1 |&1:14,16,18,20,27,28,30,32,r| |
| | Chrysin 6-C-glucoside 8-C-arabinoside Usage And Synthesis |
| Uses | Chrysin 6-C-glucoside 8-C-arabinoside can inhibit the CGRP releasing and the activation of TRPV1 channel. Chrysin 6-C-glucoside 8-C-arabinoside can be used for anti-migraine research[1]. | | IC 50 | TRPV1 | | References | [1] Zheng G, et al. Screen of anti-migraine active compounds from Duijinsan by spectrum-effect relationship analysis and molecular docking. J Ethnopharmacol. 2021 Oct 28;279:114352. DOI:10.1016/j.jep.2021.114352 |
| | Chrysin 6-C-glucoside 8-C-arabinoside Preparation Products And Raw materials |
|