Bis(2-(methoxycarbonyl)phenyl) carbonate manufacturers
|
| | Bis(2-(methoxycarbonyl)phenyl) carbonate Basic information |
| Product Name: | Bis(2-(methoxycarbonyl)phenyl) carbonate | | Synonyms: | Benzoic acid, 2,2'-[carbonylbis(oxy)]bis-, 1,1'-dimethyl ester;carbonic acid bis-(2-methoxycarbonyl-phenyl ester);methyl2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate;2,2'-(Carbonylbis(oxy))bis(methyl-1lambda5-benzoate);1,1′-Dimethyl 2,2′-[carbonylbis(oxy)]bis[benzoate];2,2'-(carbonylbis(oxy))dibenzenemacetic acidimethyl ester;Benzoic acid, 2,2'-[carbonylbis(oxy)]bis-, dimethyl ester;dimethyl 2,2'-(carbonylbis(oxy))dibenzoate | | CAS: | 82091-12-1 | | MF: | C17H14O7 | | MW: | 330.29 | | EINECS: | | | Product Categories: | | | Mol File: | 82091-12-1.mol |  |
| | Bis(2-(methoxycarbonyl)phenyl) carbonate Chemical Properties |
| Melting point | 109.5-110.2 °C | | Boiling point | 457.9±30.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | RT, stored under nitrogen | | Appearance | White to off-white Solid | | InChI | InChI=1S/C17H14O7/c1-21-15(18)11-7-3-5-9-13(11)23-17(20)24-14-10-6-4-8-12(14)16(19)22-2/h3-10H,1-2H3 | | InChIKey | QAWMIDIJFWHLAQ-UHFFFAOYSA-N | | SMILES | C(OC1=CC=CC=C1C(OC)=O)(=O)OC1=CC=CC=C1C(OC)=O |
| | Bis(2-(methoxycarbonyl)phenyl) carbonate Usage And Synthesis |
| | Bis(2-(methoxycarbonyl)phenyl) carbonate Preparation Products And Raw materials |
|