|
|
| | 2-FLUORO-6-METHOXYBENZYLAMINE Basic information |
| Product Name: | 2-FLUORO-6-METHOXYBENZYLAMINE | | Synonyms: | RARECHEM AL BW 0472;(2-Fluoro-6-methoxyphenyl)methylamine;2-Fluoro-6-methoxybenzenemethanamine;2-FLUORO-6-METHOXYBENZYLAMINE;Benzenemethanamine, 2-fluoro-6-methoxy- (9CI);1-(2-fluoro-6-methoxyphenyl)methanamine;Benzenemethanamine, 2-fluoro-6-methoxy- | | CAS: | 150517-75-2 | | MF: | C8H10FNO | | MW: | 155.17 | | EINECS: | | | Product Categories: | HALIDE;Amine | | Mol File: | 150517-75-2.mol |  |
| | 2-FLUORO-6-METHOXYBENZYLAMINE Chemical Properties |
| Boiling point | 76-77°C/3.2mm | | density | 1.127±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.72±0.10(Predicted) | | form | liquid | | color | clear | | InChI | InChI=1S/C8H10FNO/c1-11-8-4-2-3-7(9)6(8)5-10/h2-4H,5,10H2,1H3 | | InChIKey | JCXMQSDLDAJYMF-UHFFFAOYSA-N | | SMILES | C1(CN)=C(OC)C=CC=C1F |
| | 2-FLUORO-6-METHOXYBENZYLAMINE Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 2-fluoro-6-methoxybenzylamine from 2-fluoro-6-methoxybenzonitrile: 30 g of Raney nickel catalyst was added to a 1.0 L methanol solution containing 2-fluoro-6-methoxybenzonitrile (228 g, crude) and 145 mL ammonium hydroxide. The reaction mixture was transferred to an autoclave and stirred at 40 °C and 25 atm hydrogen atmosphere for 8 hours. Upon completion of the reaction, the catalyst was removed by filtration and the filtrate was concentrated under reduced pressure to give a light yellow oil. The oily material was further purified by decompression distillation to give 2-fluoro-6-methoxybenzylamine (60 g, 54% yield) as a colorless oil. The product was characterized by 1H NMR (500 MHz, DMSO-d6): δ 1.58 (s, 2H), 3.67 (s, 1H), 6.75 (t, 1H), 6.82 (d, 1H), 7.22 (dd, 1H).LC-MS analysis showed [MH]+ = 156.1. | | References | [1] Patent: WO2017/221092, 2017, A1. Location in patent: Paragraph 00154 [2] Patent: WO2017/221100, 2017, A1. Location in patent: Paragraph 00149 |
| | 2-FLUORO-6-METHOXYBENZYLAMINE Preparation Products And Raw materials |
|