| Company Name: |
Amadis Chemical Company Limited |
| Tel: |
571-89925085 |
| Email: |
sales@amadischem.com |
| Products Intro: |
Product Name:4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-1,3,2-dioxaborolane
CAS:307531-75-5
Purity:0.97 Package:mgs,gs,kgs Remarks:A820610
|
|
|
|
|
| Company Name: |
Meryer (Shanghai) Chemical Technology Co., Ltd.
|
| Tel: |
4006356688 18621169109 |
| Email: |
market03@meryer.com |
| Products Intro: |
Product Name:(E)-1-Pentene-1,2-diboronic acid bis(pinacol) ester
CAS:307531-75-5
Purity:98% Remarks:AAM176445
|
|
| | 1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PENTENE Basic information |
| Product Name: | 1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PENTENE | | Synonyms: | 1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PENTENE;(E)-1-PENTENE-1,2-DIBORONIC ACID BIS(PINACOL) ESTER;(E)-1-Pentene-1,2-diboronicacid;1-cis-1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaboralan-2-yl)pentene;Bis(pinacolcyclicester);1-cis-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxoboralan-2-yl)pentene;2,2μ-[(1Z)-1-Propyl-1,2-ethenediyl]bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], 1-[cis-1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)] pentene;2,2'-[(1Z)-1-Propyl-1,2-ethenediyl]bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolanel | | CAS: | 307531-75-5 | | MF: | C17H32B2O4 | | MW: | 322.06 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 307531-75-5.mol |  |
| | 1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PENTENE Chemical Properties |
| Melting point | 301-303 | | Boiling point | 301-303 °C(lit.) | | density | 0.954 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | 169 °F | | InChI | 1S/C17H32B2O4/c1-10-11-13(19-22-16(6,7)17(8,9)23-19)12-18-20-14(2,3)15(4,5)21-18/h12H,10-11H2,1-9H3/b13-12- | | InChIKey | MXQDNQSRLNMUOP-SEYXRHQNSA-N | | SMILES | CCC\C(=C\B1OC(C)(C)C(C)(C)O1)B2OC(C)(C)C(C)(C)O2 |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | Storage Class | 10 - Combustible liquids not in Storage Class 3 |
| | 1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PENTENE Usage And Synthesis |
| Uses | (E)-1-Pentene-1,2-diboronic acid bis(pinacol) ester can be used as a reactant in the stereoselective synthesis of γ-boryl substituted homoallylic alcohols by reacting with aromatic aldehydes via Ru-catalyzed double bond transposition reaction. | | General Description | (E)-1-Pentene-1,2-diboronic acid bis(pinacol) ester is an alkenyl boronate ester that can be utilized for Suzuki-Miyaura cross-coupling reaction. Boronate esters are air- and chromatography-stable. |
| | 1-CIS-1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PENTENE Preparation Products And Raw materials |
|