| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | H-Gly-Pro-Arg-Pro-NH2 Basic information |
| | H-Gly-Pro-Arg-Pro-NH2 Chemical Properties |
| storage temp. | -20°C | | Sequence | Gly-Pro-Arg-Pro-NH2 | | InChIKey | SCCTZYGEMPQRCV-AVGNSLFASA-N | | SMILES | NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(N)=N)C(=O)N2CCC[C@H]2C(N)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-Gly-Pro-Arg-Pro-NH2 Usage And Synthesis |
| Uses | Gly-Pro-Arg-Pro amide has been used-
- as a constituent of buffer during fluid-phase and bound thrombin inhibition assays, to determine the activity of thrombin
- for blocking fibrin polymerization and preventing fibrin clot formation in presence of α-thrombin, in blood obtained from mice
- during preparation of human soluble fibrin, to block the polymerization of soluble fibrin
| | General Description | Gly-Pro-Arg-Pro is a peptide that mimics the N-terminal Gly-Pro-Arg region in the a chain of fibrin protein. | | Biochem/physiol Actions | Gly-Pro-Arg-Pro peptide suppresses the early steps of fibrin polymerization. The amide derivative of this peptide prevents the degradation of fibrinogen and fragment D by plasmin, even in the presence of EGTA (ethylene glycol-bis(β-aminoethyl ether)-N,N,N′,N′-tetraacetic acid). |
| | H-Gly-Pro-Arg-Pro-NH2 Preparation Products And Raw materials |
|