- Methyl chlorogenate
-
- $9.80
-
2020-02-11
- CAS:123483-19-2
- Min. Order: 1g
- Purity: ＞98%
- Supply Ability: 20 tons
|
| | 3-O-Caffeoylquinic acid methyl ester Basic information |
| Product Name: | 3-O-Caffeoylquinic acid methyl ester | | Synonyms: | 3-O-Caffeoylquinic acid methyl ester;(E)-Chlorogenic acid methyl ester;3-O-Caffeoylquinic acid methyl,Methyl chlorogenate;3-caffeoylquinic acid methyl ester;Cyclohexanecarboxylic acid, 3-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4,5-trihydroxy-, methyl ester, (1S,3R,4R,5R)-;Inhibitor,inhibit,3 O Caffeoylquinic acid methyl ester,3OCaffeoylquinic acid methyl ester;3-O-Caffeoylquinic acid methyl ester, 10 mM in DMSO;Chlorogenic acid methylester | | CAS: | 123483-19-2 | | MF: | C17H20O9 | | MW: | 368.34 | | EINECS: | | | Product Categories: | Phenylpropanoids | | Mol File: | 123483-19-2.mol |  |
| | 3-O-Caffeoylquinic acid methyl ester Chemical Properties |
| Boiling point | 577.0±50.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 9.32±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C17H20O9/c1-25-16(23)17(24)7-12(20)15(22)13(8-17)26-14(21)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-20,22,24H,7-8H2,1H3/b5-3+/t12-,13-,15-,17+/m1/s1 | | InChIKey | MZNIJRAPCCELQX-AWOKGZDASA-N | | SMILES | [C@]1(O)(C(OC)=O)C[C@@H](O)[C@@H](O)[C@H](OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C1 | | LogP | 0.310 (est) |
| | 3-O-Caffeoylquinic acid methyl ester Usage And Synthesis |
| Uses | 3-O-Caffeoylquinic Acid Methyl Ester can be used for its antioxidant and tyrosinase inhibitory activities. | | Definition | ChEBI: 3-O-caffeoylquinic acid methyl ester is a quinic acid. |
| | 3-O-Caffeoylquinic acid methyl ester Preparation Products And Raw materials |
|