Obicetrapib manufacturers
- Obicetrapib
-
-
2026-07-29
- CAS:866399-87-3
- Min. Order: 1kg
- Purity: 98
- Supply Ability: 1000kgs
|
| | Obicetrapib Basic information |
| Product Name: | Obicetrapib | | Synonyms: | AMG 899;AMG 899;TA 8995;AMG899;TA8995;;AMG899;TA-8995;Obicetrapib (AMG-899,TA-8995);4-[(2-{[3,5-bis(trifluoromethyl)benzyl][(2R,45)-1-(ethoxycarbonyl)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]amino}pyrimidin-5-yl)oxy]butanoic acid;DEX-001;1(2H)-Quinolinecarboxylic acid, 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl][5-(3-carboxypropoxy)-2-pyrimidinyl]amino]-2-ethyl-3,4-dihydro-6-(trifluoromethyl)-, 1-ethyl ester, (2R,4S)- | | CAS: | 866399-87-3 | | MF: | C32H31F9N4O5 | | MW: | 722.6 | | EINECS: | | | Product Categories: | | | Mol File: | 866399-87-3.mol |  |
| | Obicetrapib Chemical Properties |
| Boiling point | 692.5±65.0 °C(Predicted) | | density | 1.394±0.06 g/cm3(Predicted) | | pka | 4.52±0.10(Predicted) | | form | Solid | | color | White to light yellow | | InChIKey | NRWORBQAOQVYBJ-GJZUVCINSA-N | | SMILES | N1(C(OCC)=O)C2=C(C=C(C(F)(F)F)C=C2)[C@@H](N(CC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)C2=NC=C(OCCCC(O)=O)C=N2)C[C@H]1CC |
| | Obicetrapib Usage And Synthesis |
| Uses | Obicetrapib, is a cholesteryl ester transfer protein (CETP) inhibitor. CETP inhibitors, can increase the concentration of high-density lipoprotein cholesterol (HDL-C), which might help to reduce the risk of cardiovascular diseases. |
| | Obicetrapib Preparation Products And Raw materials |
|