| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | tert-butyl (R)-(2-(piperidin-2-yl)ethyl)carbamate Basic information |
| Product Name: | tert-butyl (R)-(2-(piperidin-2-yl)ethyl)carbamate | | Synonyms: | tert-butyl (R)-(2-(piperidin-2-yl)ethyl)carbamate;tert-butyl N-{2-[(2R)-piperidin-2-yl]ethyl}carbamate;2-Methyl-2-propanyl {2-[(2R)-2-piperidinyl]ethyl}carbamate;(R)-2-Boc-aminoethyl-piperidine >=95%;(R)-2-Boc-aminoethyl-piperidine;Carbamic acid, N-[2-(2R)-2-piperidinylethyl]-, 1,1-dimethylethyl ester;(R)-2-Boc-aminoethyl-piperidine | | CAS: | 1821791-75-6 | | MF: | C12H24N2O2 | | MW: | 228.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1821791-75-6.mol |  |
| | tert-butyl (R)-(2-(piperidin-2-yl)ethyl)carbamate Chemical Properties |
| Boiling point | 337.3±15.0 °C(Predicted) | | density | 0.971±0.06 g/cm3(Predicted) | | form | solid | | pka | 12.90±0.46(Predicted) | | InChI | 1S/C12H24N2O2/c1-12(2,3)16-11(15)14-9-7-10-6-4-5-8-13-10/h10,13H,4-9H2,1-3H3,(H,14,15)/t10-/m1/s1 | | InChIKey | FEPKUDZBAUTEMY-SNVBAGLBSA-N | | SMILES | N1[C@H](CCCC1)CCNC(=O)OC(C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | tert-butyl (R)-(2-(piperidin-2-yl)ethyl)carbamate Usage And Synthesis |
| Uses | Chiral building block developed using Liverpool ChiroChem-patented technology. |
| | tert-butyl (R)-(2-(piperidin-2-yl)ethyl)carbamate Preparation Products And Raw materials |
|