(R)-Piperidin-2-ylmethyl-carbamic acid tert-butyl ester manufacturers
|
| | (R)-Piperidin-2-ylmethyl-carbamic acid tert-butyl ester Basic information |
| Product Name: | (R)-Piperidin-2-ylmethyl-carbamic acid tert-butyl ester | | Synonyms: | (R)-2-Boc-Aminomethylpiperidine hydrochloride;(R)-Piperidin-2-ylmethylcarbamic acid tert-butyl ester hydrochloride;Carbamic acid, (2-piperidinylmethyl)-, 1,1-dimethylethyl ester, (R)- (9CI);(R)-tert-butyl piperidin-2-ylmethylcarbamate hydrochloride;R-2-BOC-AMINOMETHYL-PIPERIDINE-HCl;(R)-tert-Butyl (piperidin-2-ylMethyl)carbaMate;CarbaMic acid, N-[(2R)-2-piperidinylMethyl]-, 1,1-diMethylethyl ester;tert-butyl N-[(2R)-piperidin-2-ylmethyl]carbamate | | CAS: | 139004-96-9 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 139004-96-9.mol |  |
| | (R)-Piperidin-2-ylmethyl-carbamic acid tert-butyl ester Chemical Properties |
| Boiling point | 321.8±15.0 °C(Predicted) | | density | 0.981±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 12.84±0.46(Predicted) | | Appearance | white solid | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-8-9-6-4-5-7-12-9/h9,12H,4-8H2,1-3H3,(H,13,14)/t9-/m1/s1 | | InChIKey | DIRUVVRMWMDZAE-SECBINFHSA-N | | SMILES | C(OC(C)(C)C)(=O)NC[C@H]1CCCCN1 |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | (R)-Piperidin-2-ylmethyl-carbamic acid tert-butyl ester Usage And Synthesis |
| Uses | Chiral building block developed using Liverpool ChiroChem-patented technology. |
| | (R)-Piperidin-2-ylmethyl-carbamic acid tert-butyl ester Preparation Products And Raw materials |
|