pyrene-2-carboxylic acid
manufacturers
|
| | pyrene-2-carboxylic acid
Basic information |
| Product Name: | pyrene-2-carboxylic acid
| | Synonyms: | Pyrene-2-carboxylic acid, HMS2876I14, HMS1473M22;2Pyrene-2-carboxylic acid;2-Pyrenecarboxylic acid;pyrene-2-carboxylic acid | | CAS: | 36428-96-3 | | MF: | C17H10O2 | | MW: | 246.26 | | EINECS: | | | Product Categories: | | | Mol File: | 36428-96-3.mol |  |
| | pyrene-2-carboxylic acid
Chemical Properties |
| Melting point | 326 °C | | Boiling point | 437.2±14.0 °C(Predicted) | | density | 1.411±0.06 g/cm3(Predicted) | | pka | 4.20±0.30(Predicted) | | InChI | InChI=1S/C17H10O2/c18-17(19)14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H,(H,18,19) | | InChIKey | JOPBIBGSCKPRBR-UHFFFAOYSA-N | | SMILES | C1=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1C(O)=O |
| | pyrene-2-carboxylic acid
Usage And Synthesis |
| | pyrene-2-carboxylic acid
Preparation Products And Raw materials |
|