| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-tert-Butylbenzylamine Basic information | | Uses |
| | 4-tert-Butylbenzylamine Chemical Properties |
| Boiling point | 235-236 °C(lit.) | | density | 0.927 g/mL at 25 °C(lit.) | | refractive index | 1.52-1.522 | | Fp | 225 °F | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | Liquid | | pka | 9.24±0.10(Predicted) | | Specific Gravity | 0.93 | | color | Clear pale yellow | | Water Solubility | Not miscible or difficult to mix with water. | | Sensitive | Air Sensitive | | BRN | 2961797 | | InChI | InChI=1S/C11H17N/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-7H,8,12H2,1-3H3 | | InChIKey | MPWSRGAWRAYBJK-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(C(C)(C)C)C=C1 | | CAS DataBase Reference | 39895-55-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-24/25 | | RIDADR | 2735 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-tert-Butylbenzylamine Usage And Synthesis |
| Uses | 4-tert-Butylbenzylamine is a useful compound in preparation of imines via TiO2-catalyzed aerobic photocatalytic oxidation of benzylic amines. | | Chemical Properties | Clear pale yellow liquid | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Uses | 4-tert-Butylbenzylamine is a useful compound in preparation of imines via TiO2-catalyzed aerobic photocatalytic oxidation of benzylic amines. |
| | 4-tert-Butylbenzylamine Preparation Products And Raw materials |
|