|
|
| | 5,5'-Bis(trifluoromethyl)-2,2'-bipyridine Basic information |
| Product Name: | 5,5'-Bis(trifluoromethyl)-2,2'-bipyridine | | Synonyms: | 5,5'-Bis(trifluoromethyl)-2,2'-bipyridine, min 97%;5-(trifluoromethyl)-2-[5-(trifluoromethyl)pyridin-2-yl]pyridine;5,5'-Bis(trifluoromethyl)-2,2'-bipyridyl;5,5'-ditrifluoromethyl-2,2'-bipyridine;2,2'-Bipyridine, 5,5'-bis(trifluoromethyl)-;5,5'-Bis(trifluoromethyl)-2,2'-bipyridine[5,5′-dCF3bpy];5-(trifluoromethyl)-2-[5-(trifluoromethyl)pyridin-2-yl]pyridine ISO 9001：2015 REACH;5,5'-Bis(trifluoromethyl)-2,2'-bipyridine | | CAS: | 142946-80-3 | | MF: | C12H6F6N2 | | MW: | 292.18 | | EINECS: | | | Product Categories: | | | Mol File: | 142946-80-3.mol |  |
| | 5,5'-Bis(trifluoromethyl)-2,2'-bipyridine Chemical Properties |
| Melting point | 129.0 to 133.0 °C | | Boiling point | 275.3±35.0 °C(Predicted) | | density | 1.403±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 1.39±0.32(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H6F6N2/c13-11(14,15)7-1-3-9(19-5-7)10-4-2-8(6-20-10)12(16,17)18/h1-6H | | InChIKey | ZHMXQYAUGQASQM-UHFFFAOYSA-N | | SMILES | C1(C2=NC=C(C(F)(F)F)C=C2)=NC=C(C(F)(F)F)C=C1 |
| | 5,5'-Bis(trifluoromethyl)-2,2'-bipyridine Usage And Synthesis |
| Uses | 5,5′-Bis(trifluoromethyl)-2,2′-bipyridine is a ligand used for the preparation of Ir(III) photocatalysts. | | reaction suitability | reaction type: Photocatalysis
reagent type: catalyst |
| | 5,5'-Bis(trifluoromethyl)-2,2'-bipyridine Preparation Products And Raw materials |
|