| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-oxo-C12-aniline Basic information |
| | 3-oxo-C12-aniline Chemical Properties |
| storage temp. | -20°C | | form | solid | | InChI | 1S/C18H27NO2/c1-2-3-4-5-6-7-11-14-17(20)15-18(21)19-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3,(H,19,21) | | InChIKey | GYOZLHQAMICVMN-UHFFFAOYSA-N | | SMILES | CCCCCCCCCC(CC(NC1=CC=CC=C1)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-oxo-C12-aniline Usage And Synthesis |
| Uses | This analog mimics the native 3-oxo-C12 AHL signal utilized by Pseudomonas aeruginosa for quorum sensing, yet contains a non-hydrolysable aniline head group. 3-oxo-C12-aniline is a strong inhibitor of the LasR receptor in P. aeruginosa. |
| | 3-oxo-C12-aniline Preparation Products And Raw materials |
|