|
|
| | Atorvastatin Acetonide tert-Butyl Ester Basic information |
| Product Name: | Atorvastatin Acetonide tert-Butyl Ester | | Synonyms: | (4R-CIS)-[1,1-DIMETHYLETHYL-6-[(2-FLUOROPHENYL)-5-(1-METHYLETHYL)-3-PHENYL-4-[(PHENYLAMINO) CARBONYL]-1H-PYRROL-1-YL]ETHYL]-2, 2-DIMETHYL-1, 3-DIOXANE-4-ACETATE;(4R-CIS)-6-[2-[2-(4-FLUOROPHENYL)-5-(1-METHYLETHYL)-3-PHENYL-4-[(PHENYLAMINO)CARBONYL]-1H-PYRROL-1-YL]ETHYL]-2,2-DIMETHYL-1,3-DIOXANE-4-ACETIC ACID, 1,1-DIMETHYLETHYL ESTER;L-1(4R-Cis)-1,1-DiMethylethyl-6- 2- 2-(4-Fluorophenyl)-5-(1-Isopropyl)-3-Phenyl-4 (PhenylaMino)carbonyl -1H-pyrrol-1-yl Ethyl -2,2-DiMethyl-1,3-Dioxane-4-Acetate;tert-butyl (4r,6r)-2-[[[6-(2-4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate;tert-Butyl (4R,6R)-6-[2-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1-pyrrolyl]ethyl]-2,2-dimethyl-1,3-dioxane-4-acetate
;tert-Butyl 2-[(4R,6R)-6-[2-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl];(4R-cis)-1,1-dimethylethyl-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxane-4-acetate;Atorvastatin Calcium Impurity E | | CAS: | 125971-95-1 | | MF: | C40H47FN2O5 | | MW: | 654.81 | | EINECS: | 700-258-0 | | Product Categories: | INTERMEDIATES OF ATORVASTATIN;Intermediates & Fine Chemicals. Pfizer compounds;(intermediate of atorvastatin);Chiral Reagents;Intermediates;Intermediates & Fine Chemicals;Pharmaceuticals;Asymmetric Synthesis;Chiral Building Blocks;Complex Molecules;ZJ | | Mol File: | 125971-95-1.mol |  |
| | Atorvastatin Acetonide tert-Butyl Ester Chemical Properties |
| Melting point | 144-148 °C(lit.) | | alpha | 6.5 º (c=1, chloroform) | | Boiling point | 678.0±55.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.57±0.70(Predicted) | | color | White | | Optical Rotation | [α]20/D +6.5°, c = 1 in chloroform | | InChIKey | NPPZOMYSGNZDKY-ROJLCIKYSA-N | | SMILES | O1[C@H](CCN2C(C(C)C)=C(C(NC3=CC=CC=C3)=O)C(C3=CC=CC=C3)=C2C2=CC=C(F)C=C2)C[C@H](CC(OC(C)(C)C)=O)OC1(C)C | | CAS DataBase Reference | 125971-95-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | RIDADR | UN 2811 6.1 / PGII | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | Atorvastatin Acetonide tert-Butyl Ester Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Atorvastatin Acetonide tert-Butyl Ester (Atorvastatin EP Impurity I) is an Atorvastatin intermediate. |
| | Atorvastatin Acetonide tert-Butyl Ester Preparation Products And Raw materials |
|