| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(2-Nitrophenyl)-1,2-ethanediol Basic information |
| Product Name: | 1-(2-Nitrophenyl)-1,2-ethanediol | | Synonyms: | o-Nitrostyrene glycol;2-nitrophenyl glycol;2-NITROSTYRENE GLYCOL;1-(2-NITROPHENYL)-1,2-ETHANEDIOL;1,2-Ethanediol, 1-(2-nitrophenyl)-;1-(2-Nitrophenyl)-1,2-ethanediol 98% | | CAS: | 51673-59-7 | | MF: | C8H9NO4 | | MW: | 183.16 | | EINECS: | | | Product Categories: | | | Mol File: | 51673-59-7.mol |  |
| | 1-(2-Nitrophenyl)-1,2-ethanediol Chemical Properties |
| Melting point | 96-98 °C (lit.) | | Boiling point | 398.7±27.0 °C(Predicted) | | density | 1.410±0.06 g/cm3(Predicted) | | pka | 13.02±0.20(Predicted) | | InChI | 1S/C8H9NO4/c10-5-8(11)6-3-1-2-4-7(6)9(12)13/h1-4,8,10-11H,5H2 | | InChIKey | AYVFQXVSRJXIDT-UHFFFAOYSA-N | | SMILES | OCC(O)c1ccccc1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(2-Nitrophenyl)-1,2-ethanediol Usage And Synthesis |
| Synthesis Reference(s) | Canadian Journal of Chemistry, 61, p. 400, 1983 DOI: 10.1139/v83-072 |
| | 1-(2-Nitrophenyl)-1,2-ethanediol Preparation Products And Raw materials |
|