|
|
| | Boc-AMCP-OH Basic information |
| Product Name: | Boc-AMCP-OH | | Synonyms: | 1-(TERT-BUTYLOXYCARBONYL-AMINOMETHYL)-CYCLOPROPYL-1-CARBOXYLIC ACID;1-(T-BUTYLOXYCARBONYL-AMINOMETHYL)-CYCLOPROPYL-1-CARBOXYLIC ACID;1-(BOC-AMINOMETHYL)CYCLOPROPYL-1-CARBOXYLIC ACID;BOC-ACPA-OH;1-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]cyclopropanecarboxylic acid;1-Bocaminomethyl-cyclopropanecarboxylic acid, 98%;Cyclopropanecarboxylic acid, 1-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-;N-Boc-Aminomethylcyclopropyl-1-carboxylic acid | | CAS: | 204376-48-7 | | MF: | C10H17NO4 | | MW: | 215.25 | | EINECS: | | | Product Categories: | | | Mol File: | 204376-48-7.mol |  |
| | Boc-AMCP-OH Chemical Properties |
| Melting point | 118-122.°C | | Boiling point | 361.0±15.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.49±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H17NO4/c1-9(2,3)15-8(14)11-6-10(4-5-10)7(12)13/h4-6H2,1-3H3,(H,11,14)(H,12,13) | | InChIKey | UGPTVCJIZPFGLU-UHFFFAOYSA-N | | SMILES | C1(CNC(OC(C)(C)C)=O)(C(O)=O)CC1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 |
| | Boc-AMCP-OH Usage And Synthesis |
| Chemical Properties | White crystalline powder |
| | Boc-AMCP-OH Preparation Products And Raw materials |
|