|
|
| | 4-bromo-1,2,3,5,6,7-hexahydro-s-Indacene Basic information |
| Product Name: | 4-bromo-1,2,3,5,6,7-hexahydro-s-Indacene | | Synonyms: | 4-bromo-1,2,3,5,6,7-hexahydro-s-Indacene;184842;s-Indacene, 4-bromo-1,2,3,5,6,7-hexahydro- | | CAS: | 108722-46-9 | | MF: | C12H13Br | | MW: | 237.14 | | EINECS: | | | Product Categories: | | | Mol File: | 108722-46-9.mol |  |
| | 4-bromo-1,2,3,5,6,7-hexahydro-s-Indacene Chemical Properties |
| Boiling point | 319.2±42.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C12H13Br/c13-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12/h7H,1-6H2 | | InChIKey | JXUDTIMNBBRXGB-UHFFFAOYSA-N | | SMILES | C1C2=C(C(Br)=C3C(=C2)CCC3)CC1 |
| | 4-bromo-1,2,3,5,6,7-hexahydro-s-Indacene Usage And Synthesis |
| | 4-bromo-1,2,3,5,6,7-hexahydro-s-Indacene Preparation Products And Raw materials |
|