| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
n-Butyl ricinoleate manufacturers
- N-BUTYL RICINOLEATE
-
-
2025-12-24
- CAS:151-13-3
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
|
| | n-Butyl ricinoleate Basic information |
| Product Name: | n-Butyl ricinoleate | | Synonyms: | RICINOLEIC ACID N-BUTYL ESTER;RICINOLEIC ACID BUTYL ESTER;RICINOLIC ACID N-BUTYL ESTER;N-BUTYL 12-HYDROXY-9-OCTADECENOATE;N-BUTYL 12-HYDROXYOLEATE;ricinolicacidbutylester;Ricinoleinacidbutylester;9-Octadecenoic acid, 12-hydroxy-, butyl ester, (9Z,12R)- | | CAS: | 151-13-3 | | MF: | C22H42O3 | | MW: | 354.57 | | EINECS: | 205-785-5 | | Product Categories: | | | Mol File: | 151-13-3.mol |  |
| | n-Butyl ricinoleate Chemical Properties |
| Melting point | -10°C | | Boiling point | 185°C 1mm | | density | 0,919 g/cm3 | | Pour Point | -26 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.4580-1.4620 | | Fp | 115 °C | | solubility | Insoluble in water, soluble in alcohol and oils | | form | Liquid | | pka | 15.10±0.20(Predicted) | | color | Colourless oily liquid | | Water Solubility | 3.051μg/L at 25℃ | | InChI | InChI=1S/C7H3F11O/c1-2(19)3(8,9)4(10,11)5(12,13)6(14,15)7(16,17)18/h1H3 | | InChIKey | HGWAKQDTQVDVRP-OKULMJQMSA-N | | SMILES | O[C@H](CCCCCC)C\C=C/CCCCCCCC(=O)OCCCC | | LogP | 7.95 at 25℃ | | CAS DataBase Reference | 151-13-3(CAS DataBase Reference) | | EPA Substance Registry System | 9-Octadecenoic acid, 12-hydroxy-, butyl ester, (9Z,12R)- (151-13-3) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2918.19.9000 | | Storage Class | 10 - Combustible liquids |
| | n-Butyl ricinoleate Usage And Synthesis |
| Chemical Properties | n-Butyl ricinoleate has a Very faint oily odour, strongly dependent upon the purity of the chemical. Suggested for use in perfume formulation to lend “oily” petal-like notes to certain floral bases. | | Uses | Butyl Ricinoleate is a fatty acid ester biolubricant which are synthesized as environmentally friendly products. | | Production Methods | n-Butyl ricinoleate is produced from n-Butanol and Ricinoleic acid by heat. | | Flammability and Explosibility | Not classified |
| | n-Butyl ricinoleate Preparation Products And Raw materials |
|