|
|
| | {2-[(4-{[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl}-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl}-carbamic acid tert-butyl ester Basic information |
| | {2-[(4-{[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl}-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl}-carbamic acid tert-butyl ester Chemical Properties |
| Boiling point | 775.5±60.0 °C(Predicted) | | density | 1.093±0.06 g/cm3(Predicted) | | pka | 11.79±0.46(Predicted) |
| | {2-[(4-{[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl}-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl}-carbamic acid tert-butyl ester Usage And Synthesis |
| Uses | Ph-Bis(C1-N-(C2-NH-Boc)2) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | Biological Activity | Ph-Bis(C1-N-(C2-NH-Boc)2) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. | | IC 50 | Alkyl-Chain | | References | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
| | {2-[(4-{[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl}-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl}-carbamic acid tert-butyl ester Preparation Products And Raw materials |
|