Trifarotene manufacturers
- Trifarotene
-
-
2026-09-14
- CAS:895542-09-3
- Min. Order: 1g
- Purity: More Than 99%
- Supply Ability: 100kg/Month
- trifarotene
-
- $35.00
-
2026-06-02
- CAS:895542-09-3
- Purity: 99.78%
- Supply Ability: 10g
|
| | Trifarotene Basic information |
| Product Name: | Trifarotene | | Synonyms: | 4-[3-(3-tert-butyl-4-pyrrolidin-1-ylphenyl)-4-(2-hydroxyethoxy)phenyl]benzoic acid;[1,1':3',1''-Terphenyl]-4-carboxylic acid, 3''-(1,1-dimethylethyl)-4'-(2-hydroxyethoxy)-4''-(1-pyrrolidinyl)-;RAR/RXR,inhibit,trifarotene,CD-5789,Autophagy,RAR,Retinoid X receptors,acne,CD 5789,Retinoic acid receptors,Inhibitor,selective;Trofarotene.;trifarotene, 10 mM in DMSO;Qufarotine;3''-(tert-Butyl)-4'-(2-hydroxyethoxy)-4''-(pyrrolidin-1-yl)-[1,1':3',1''-terphenyl]-4-carboxylic acid;Trifarotene (CD5789) | | CAS: | 895542-09-3 | | MF: | C29H33NO4 | | MW: | 459.58 | | EINECS: | | | Product Categories: | API | | Mol File: | 895542-09-3.mol |  |
| | Trifarotene Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO:250.0(Max Conc. mg/mL);543.97(Max Conc. mM) | | form | Solid | | color | White to Off-White | | InChIKey | MFBCDACCJCDGBA-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OCCO)C(C3=CC=C(N4CCCC4)C(C(C)(C)C)=C3)=C2)=CC=C(C(O)=O)C=C1 |
| | Trifarotene Usage And Synthesis |
| Uses | Trifarotene, is a retinoic acid receptor (RAR) agonist. |
| | Trifarotene Preparation Products And Raw materials |
|