|
|
| | 2,7-Dimethoxy-quinoline-3-carbaldehyde Basic information |
| Product Name: | 2,7-Dimethoxy-quinoline-3-carbaldehyde | | Synonyms: | TIMTEC-BB SBB011346;IFLAB-BB F2102-0013;AKOS BBS-00005364;2,7-Dimethoxy-3-quinolinecarbaldehyde;2,7-dimethoxyquinoline;2,7-dimethoxyquinoline-3-carboxaldehyde;3-Quinolinecarboxaldehyde, 2,7-dimethoxy-;2,7-Dimethoxy-3-quinolinecarboxaldehyde | | CAS: | 95395-23-6 | | MF: | C12H11NO3 | | MW: | 217.22 | | EINECS: | | | Product Categories: | | | Mol File: | 95395-23-6.mol |  |
| | 2,7-Dimethoxy-quinoline-3-carbaldehyde Chemical Properties |
| Melting point | 151-152 °C(Solv: methanol (67-56-1)) | | Boiling point | 373.5±37.0 °C(Predicted) | | density | 1.231±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 1.87±0.50(Predicted) | | InChI | 1S/C12H11NO3/c1-15-10-4-3-8-5-9(7-14)12(16-2)13-11(8)6-10/h3-7H,1-2H3 | | InChIKey | PQECIFGEZCZGSO-UHFFFAOYSA-N | | SMILES | COc1ccc2cc(C=O)c(OC)nc2c1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-41 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 2,7-Dimethoxy-quinoline-3-carbaldehyde Usage And Synthesis |
| | 2,7-Dimethoxy-quinoline-3-carbaldehyde Preparation Products And Raw materials |
|