|
|
| | Homoeriodictyol 7-O-glucoside Basic information |
| Product Name: | Homoeriodictyol 7-O-glucoside | | Synonyms: | Homoeriodictyol 7-O-glucoside;Homoeriodictyol 7-O-β-D-glucoside;4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-, (2S)- | | CAS: | 14982-11-7 | | MF: | C22H24O11 | | MW: | 464.42 | | EINECS: | | | Product Categories: | | | Mol File: | 14982-11-7.mol |  |
| | Homoeriodictyol 7-O-glucoside Chemical Properties |
| Melting point | 175-176 °C | | Boiling point | 805.2±65.0 °C(Predicted) | | density | 1.569±0.06 g/cm3(Predicted) | | pka | 7.15±0.40(Predicted) | | InChIKey | KZQCCKUDYVSOLC-MRBBKGJENA-N | | SMILES | O=C1C[C@@H](C2C=CC(O)=C(OC)C=2)OC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=CC(O)=C12 |&1:3,18,19,20,22,24,r| |
| | Homoeriodictyol 7-O-glucoside Usage And Synthesis |
| Uses | Homoeriodictyol 7-O-β-D-glucoside is a natural platelet-activating factor (PAF) antagonist. Homoeriodictyol 7-O-β-D-glucoside inhibits human and rabbit platelet aggregation induced by PAF, with an IC50 of 0.8 μM[1]. | | References | [1] Zengwei G, et, al. A novel platelet-activating factor antagonist isolated from a Chinese herbal drug Viscum coloratum. |
| | Homoeriodictyol 7-O-glucoside Preparation Products And Raw materials |
|