| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-(N-Styrylmethyl-2-aminoethylamino)propyltrimethoxysilane hydrochloride Basic information |
| | 3-(N-Styrylmethyl-2-aminoethylamino)propyltrimethoxysilane hydrochloride Chemical Properties |
| density | 0.905 g/mL at 25 °C | | refractive index | n20/D 1.402 | | Fp | 55 °F | | form | liquid | | InChI | 1S/C17H30N2O3Si.ClH/c1-5-16-7-9-17(10-8-16)15-19-13-12-18-11-6-14-23(20-2,21-3)22-4;/h5,7-10,18-19H,1,6,11-15H2,2-4H3;1H | | InChIKey | JWIKADZFCMEWBV-UHFFFAOYSA-N | | SMILES | Cl.CO[Si](CCCNCCNCc1ccc(C=C)cc1)(OC)OC | | EPA Substance Registry System | 1,2-Ethanediamine, N-[(4-ethenylphenyl)methyl]-N'-[3-(trimethoxysilyl)propyl]-, monohydrochloride (33401-49-9) |
| Hazard Codes | F,T | | Risk Statements | 11-41-43-39/23/24/25-23/24/25 | | Safety Statements | 7-16-23-45-36/37 | | RIDADR | UN 1230 3/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | 3-(N-Styrylmethyl-2-aminoethylamino)propyltrimethoxysilane hydrochloride Usage And Synthesis |
| | 3-(N-Styrylmethyl-2-aminoethylamino)propyltrimethoxysilane hydrochloride Preparation Products And Raw materials |
|