| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (Methyldiphenylsilyl)acetylene Basic information |
| | (Methyldiphenylsilyl)acetylene Chemical Properties |
| Boiling point | 86 °C0.05 mm Hg(lit.) | | density | 1.01 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.575(lit.) | | Fp | >230 °F | | form | liquid | | Specific Gravity | 1.010 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/C15H14Si/c1-3-16(2,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h1,4-13H,2H3 | | InChIKey | XSXNZQAPLNNSCP-UHFFFAOYSA-N | | SMILES | C[Si](C#C)(c1ccccc1)c2ccccc2 |
| WGK Germany | 3 | | TSCA | No | | Storage Class | 10 - Combustible liquids |
| | (Methyldiphenylsilyl)acetylene Usage And Synthesis |
| Uses | (Methyldiphenylsilyl)acetylene (diphenylmethylethynylsilane) may be used in the synthesis of diphenylmethylsilyl-substituted isoxazoles, via [2+3] cycloaddition reaction with nitile oxides. | | General Description | (Methyldiphenylsilyl)acetylene is an organic building block. Various physical properties (boiling point and density) of (methyldiphenylsilyl)acetylene have been reported. |
| | (Methyldiphenylsilyl)acetylene Preparation Products And Raw materials |
|