| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 2-chlorophenylacetate Basic information |
| Product Name: | Methyl 2-chlorophenylacetate | | Synonyms: | METHYL 2-CHLOROPHENYLACETATE;Methyl 2-(2-chlorophenyl)acetate ,98%;2-Chlorobenzeneacetic acid methyl ester;2-Chloro Phenyl acetic Acid Methyl Ester , (Methyl 2-chlorophenylagetate);Methyl 2-chlorophenylacetate,98%;O-Chloro-phenylacetic acid methyl ester;Benzeneacetic acid, 2-chloro-, methyl ester;2-(2-chlorophenyl)propanoate | | CAS: | 57486-68-7 | | MF: | C9H9ClO2 | | MW: | 184.62 | | EINECS: | 260-764-8 | | Product Categories: | Aromatic Esters | | Mol File: | 57486-68-7.mol |  |
| | Methyl 2-chlorophenylacetate Chemical Properties |
| Boiling point | 128 °C / 23mmHg | | density | 1.21 | | refractive index | 1.524-1.526 | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless | | InChI | InChI=1S/C9H9ClO2/c1-12-9(11)6-7-4-2-3-5-8(7)10/h2-5H,6H2,1H3 | | InChIKey | KHBWTRFWQROKJZ-UHFFFAOYSA-N | | SMILES | C1(CC(OC)=O)=CC=CC=C1Cl | | CAS DataBase Reference | 57486-68-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ACROS
| English |
| | Methyl 2-chlorophenylacetate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Synthesis | To a solution of o-chlorophenylacetic acid (1.04 g, 6 mmol) in methanol (25 mL) was added concentrated sulfuric acid (6 drops) and the reaction mixture was heated to reflux for 16 hours. Upon completion of the reaction, the methanol was removed by concentration under reduced pressure, and the residue was dissolved in ethyl acetate and washed with saturated aqueous sodium bicarbonate, water and saturated aqueous sodium chloride in that order. The organic layer was dried with anhydrous sodium sulfate, filtered and concentrated under reduced pressure to give o-chlorophenylacetic acid methyl ester (1.08 g, yield 97.5%) as a light yellow oil.GC-MS (EI) m/z: 184, 186 [M+]. | | References | [1] Bioorganic and Medicinal Chemistry, 2003, vol. 11, # 13, p. 2843 - 2866 [2] Tetrahedron Letters, 2003, vol. 44, # 2, p. 331 - 334 [3] Patent: WO2005/7165, 2005, A1. Location in patent: Page 43 [4] Patent: WO2005/7633, 2005, A1. Location in patent: Page 30-31 [5] Bioorganic and Medicinal Chemistry Letters, 2013, vol. 23, # 20, p. 5515 - 5518 |
| | Methyl 2-chlorophenylacetate Preparation Products And Raw materials |
|