| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,1'-Binaphthyl-2,2'-diamine Basic information | | Description |
| Product Name: | 1,1'-Binaphthyl-2,2'-diamine | | Synonyms: | (+/-)-1,1'-BINAPHTHALENE-2,2'-DIAMINE;(+/-)-2,2'-DIAMINO-1,1'-BINAPHTHALENE;2,2-DIAMINO-1,1'-BINAPHTHALENE;-diamine 99+% (HPLC);RACEMIC-2,2'-DIAMINO-1,1'-BINAPHTHYL, MIN. 96%;1,1-BINAPHY1-2,2'-DIAMINE;(+/-)-2,2'-Diamino-1,1'-binaphthyl;racemic-2,2'-Diamino-1,1'-binaphthyl,min.96% | | CAS: | 4488-22-6 | | MF: | C20H16N2 | | MW: | 284.35 | | EINECS: | | | Product Categories: | Achiral Nitrogen;BINAM Series;Nitrogen Compounds;Organic Building Blocks;Polyamines | | Mol File: | 4488-22-6.mol |  |
| | 1,1'-Binaphthyl-2,2'-diamine Chemical Properties |
| Melting point | 242-244 °C(lit.) | | Boiling point | 416.85°C (rough estimate) | | density | 1.249 | | refractive index | 1.6450 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.79±0.10(Predicted) | | color | slightly beige | | Optical Rotation | -0.3137°(C=1.0043g/100ml DCM) | | Water Solubility | Insoluble in water | | λmax | 355nm(neat)(lit.) | | InChI | InChI=1S/C20H16N2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12H,21-22H2 | | InChIKey | DDAPSNKEOHDLKB-UHFFFAOYSA-N | | SMILES | C1(C2=C3C(C=CC=C3)=CC=C2N)=C2C(C=CC=C2)=CC=C1N |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-41-22 | | Safety Statements | 26-39 | | WGK Germany | 3 | | RTECS | DU3090000 | | F | 10 | | HS Code | 29215900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 1,1'-Binaphthyl-2,2'-diamine Usage And Synthesis |
| Description | 1,1'-Binaphthalene]-2,2'-diamine is an axially asymmetric binaphthyl ligand mainly used in enantioselective catalysis. | | Chemical Properties | off-white to beige-pink powder | | Uses | Novel axially chiral Rh N-heterocyclic carbene complexes were prepared from axially dissymmetric 1,1'-Binaphthalene]-2,2'-diamine and applied in the Rh-catalyzed enantioselective hydrosilylation of methyl ketones. The enantioselective direct aldol reaction, organocatalyzed by recoverable BINAM- prolinamide derivatives can be highly accelerated by a catalytic amount of a carboxylic acid without a detrimental of the obtained enantioselectivities. | | Safety Profile | Questionable carcinogen withexperimental tumorigenic data. When heated todecomposition it emits toxic fumes of NOx. |
| | 1,1'-Binaphthyl-2,2'-diamine Preparation Products And Raw materials |
|