| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Malonaldehyde bis(phenylimine) monohydrochloride Basic information |
| | Malonaldehyde bis(phenylimine) monohydrochloride Chemical Properties |
| Melting point | 218 °C (dec.)(lit.) | | storage temp. | -70°C | | solubility | methanol: 2.5%, clear, yellow to orange | | form | powder | | color | clear colorless | | biological source | rabbit | | Water Solubility | Soluble in water (partly). | | Sensitive | Hygroscopic | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C15H14N2.ClH/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15;/h1-6,8-13H,7H2;1H/b16-12+,17-13+; | | InChIKey | FLMLOZWXXPLHIE-IEEHZGKWSA-N | | SMILES | Cl.C(\C=N\c1ccccc1)\C=N\c2ccccc2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | Malonaldehyde bis(phenylimine) monohydrochloride Usage And Synthesis |
| Uses | Malonaldehyde bis(phenylimine) monohydrochloride is a useful fluorescent cyanine dye. | | Biological Activity | MAX dimerization protein belongs to a subfamily of MAX-interacting proteins. This protein competes with MYC for binding to MAX to form a sequence-specific DNA-binding complex, acting as a transcriptional repressor (while MYC appears to function as an activator) and is a candidate tumor suppressor. Both Myc and Mad, as well as the more recently described Mnt and Mga proteins, form heterodimers with Max, permitting binding to specific DNA sequences. These DNA-bound heterodimers recruit coactivator or corepressor complexes th at generate alterations in chromatin structure, which in turn modulate transcription. The wild-type c-Myc and c-Myc/MadBR proteins have indistinguishable biological activity and target gene recognition in vivo. |
| | Malonaldehyde bis(phenylimine) monohydrochloride Preparation Products And Raw materials |
|