| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-HEPTYL-4-(4-PYRIDYL)PYRIDINIUM BROMIDE Basic information |
| | 1-HEPTYL-4-(4-PYRIDYL)PYRIDINIUM BROMIDE Chemical Properties |
| Melting point | 125-128 °C(lit.) | | storage temp. | room temp | | form | Powder | | color | White to yellow | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C17H23N2.BrH/c1-2-3-4-5-6-13-19-14-9-17(10-15-19)16-7-11-18-12-8-16;/h7-12,14-15H,2-6,13H2,1H3;1H/q+1;/p-1 | | InChIKey | GBJHAEPTEZMDHU-UHFFFAOYSA-M | | SMILES | [Br-].CCCCCCC[n+]1ccc(cc1)-c2ccncc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-HEPTYL-4-(4-PYRIDYL)PYRIDINIUM BROMIDE Usage And Synthesis |
| Uses | 1-Heptyl-4-(4-pyridyl)pyridinium Bromide is a dye/stain. Dyes and metabolites. |
| | 1-HEPTYL-4-(4-PYRIDYL)PYRIDINIUM BROMIDE Preparation Products And Raw materials |
|