BUTURON manufacturers
- BUTURON
-
- $1.00 / 1KG
-
2020-01-01
- CAS:3766-60-7
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | BUTURON Basic information |
| | BUTURON Chemical Properties |
| Melting point | 149℃ | | Boiling point | 394.9±42.0 °C(Predicted) | | density | 1.233 | | refractive index | 1.6000 (estimate) | | Fp | >100 °C | | storage temp. | 0-6°C | | pka | 13.69±0.70(Predicted) | | Water Solubility | 30mg/L(20 ºC) | | BRN | 2941811 | | Major Application | agriculture
environmental | | InChI | 1S/C12H13ClN2O/c1-4-9(2)15(3)12(16)14-11-7-5-10(13)6-8-11/h1,5-9H,2-3H3,(H,14,16) | | InChIKey | BYYMILHAKOURNM-UHFFFAOYSA-N | | SMILES | CC(C#C)N(C)C(=O)Nc1ccc(Cl)cc1 | | EPA Substance Registry System | Buturon (3766-60-7) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | YS6475000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | mouse,LD50,intraperitoneal,500mg/kg (500mg/kg),"Wirksubstanzen der Pflanzenschutz und Schadlingsbekampfungsmittel," Perkow, W., Berlin, Verlag Paul Parey, 1971-1976Vol. -, Pg. -, 1971/1976. |
| | BUTURON Usage And Synthesis |
| Uses | Buturon may be used as an analytical reference standard for the quantification of the analyte in aqueous samples using various chromatographic techniques.', 'Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | Definition | ChEBI: Buturon is a member of ureas. |
| | BUTURON Preparation Products And Raw materials |
|