|
|
| | Bisphenol F bis(3-chloro-2-hydroxypropyl) ether Basic information |
| | Bisphenol F bis(3-chloro-2-hydroxypropyl) ether Chemical Properties |
| Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C19H22Cl2O4/c20-10-16(22)12-24-18-5-1-14(2-6-18)9-15-3-7-19(8-4-15)25-13-17(23)11-21/h1-8,16-17,22-23H,9-13H2 | | InChIKey | VQXSOBIULOLCHO-UHFFFAOYSA-N | | SMILES | OC(CCl)COc1ccc(Cc2ccc(OCC(O)CCl)cc2)cc1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Bisphenol F bis(3-chloro-2-hydroxypropyl) ether Usage And Synthesis |
| Uses | Bisphenol F diglycidyl ether, their derivatives and bisphenol A diglycidyl ether have been studied for their anti-androgenic effects, using cells stably transfected with human androgen receptor, AR-EcoScreen. |
| | Bisphenol F bis(3-chloro-2-hydroxypropyl) ether Preparation Products And Raw materials |
|