| Company Name: |
Tianjing Geneston Bio-tech Co.,Ltd. Gold
|
| Tel: |
022-60131465 18920720807 |
| Email: |
zishan_1986@163.com |
| Products Intro: |
Product Name:6-METHOXY-1-BROMO NAPHTHALENE CAS:83710-62-7 Purity:98%
|
|
| | 6-METHOXY-1-BROMO NAPHTHALENE Basic information |
| | 6-METHOXY-1-BROMO NAPHTHALENE Chemical Properties |
| Boiling point | 124.5-126.0 °C(Press: 0.8 Torr) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C11H9BrO/c1-13-9-5-6-10-8(7-9)3-2-4-11(10)12/h2-7H,1H3 | | InChIKey | YWYUBKSTSJQFQI-UHFFFAOYSA-N | | SMILES | C1(Br)=C2C(C=C(OC)C=C2)=CC=C1 |
| | 6-METHOXY-1-BROMO NAPHTHALENE Usage And Synthesis |
| | 6-METHOXY-1-BROMO NAPHTHALENE Preparation Products And Raw materials |
|