| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Magnesium naphthenate Basic information |
| | Magnesium naphthenate Chemical Properties |
| form | liquid | | color | dark | | InChI | InChI=1S/2C11H8O2.Mg/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2 | | InChIKey | OFUAIAKLWWIPTC-UHFFFAOYSA-L | | SMILES | [Mg+2].C1=C2C(C=CC=C2)=CC=C1C([O-])=O.C1=C2C(C=CC=C2)=CC=C1C([O-])=O | | EPA Substance Registry System | Naphthenic acids, magnesium salts (68424-71-5) |
| Provider | Language |
|
ALFA
| English |
| | Magnesium naphthenate Usage And Synthesis |
| Uses | Magnesium naphthenate is used in detergent and dispersant for internal combustion engine oils and fuel oils. |
| | Magnesium naphthenate Preparation Products And Raw materials |
|