|
|
| | 1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE Basic information |
| Product Name: | 1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE | | Synonyms: | 1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDO[1,2-A]PYRIMIDINE;1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE;1-Methyl-1,3,4,6,7,8-hexahydro-2H-pyrimido[1,2-a]pyrimidine;2H-Pyrimido[1,2-a]pyrimidine, 1,3,4,6,7,8-hexahydro-1-methyl-;1,3,4,6,7,8-hexahydro-1-methyl-2H-pyrimido(1,2-A);MTBD, 1,3,4,6,7,8-Hexahydro-1-methyl-2H-pyrimido[1,2-a]pyrimidine;1,2,3,4,6,7-Hexahydro-1-methyl-8H-pyrimido[1,2-a]pyrimidine;1-Methyl-1,2,3,4,7,8-hexahydro-6H-pyrimido[1,2-a]pyrimidine | | CAS: | 84030-20-6 | | MF: | C8H15N3 | | MW: | 153.22 | | EINECS: | 281-791-1 | | Product Categories: | Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks;N-Containing;Others | | Mol File: | 84030-20-6.mol | ![1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE Structure](CAS/GIF/84030-20-6.gif) |
| | 1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE Chemical Properties |
| Boiling point | 75-79 °C0.1 mm Hg(lit.) | | density | 1.067 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.537(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | pka | 14.37±0.20(Predicted) | | form | clear liquid | | color | Colorless to Yellow to Orange | | BRN | 7635759 | | InChI | InChI=1S/C8H15N3/c1-10-5-3-7-11-6-2-4-9-8(10)11/h2-7H2,1H3 | | InChIKey | OEBXWWBYZJNKRK-UHFFFAOYSA-N | | SMILES | C12=NCCCN1CCCN2C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | F | 10 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29335990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 7-Methyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene may be used in microwave-promoted, palladium-catalyzed C-N bond-forming reactions with aryl/heteroaryl nonaflates and amines. It may be used as strong base to investigate the podand solvents, tris(oxaalkyl)phenylsilanes and tris(oxaalkyl)phosphates. | | General Description | 7-Methyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene is a soluble amine base. It forms 1:1 complexes with 4-nitrophenyl[bis(diethylsulfonyl)]methane and phenyl[bis(diethylsulfonyl)]methane and their structures have been studied by FT-IR, 1H NMR and PM5 semiempirical methods. Catalytic performance of 7-methyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene for the transesterification of rapseed oil with methanol has been investigated. |
| | 1,3,4,6,7,8-HEXAHYDRO-1-METHYL-2H-PYRIMIDOL[1,2-A]PYRIMIDINE Preparation Products And Raw materials |
|