|
|
| | 1,1'-Dibenzyl-4,4'-bipyridinium dichloride Basic information |
| Product Name: | 1,1'-Dibenzyl-4,4'-bipyridinium dichloride | | Synonyms: | BENZYL VIOLOGEN;BENZYL VIOLOGEN DICHLORIDE SALT;1,1’-bis(phenylmethyl)-4,4’-bipyridiniumdichloride;4’-bipyridinium,1,1’-dibenzyl-dichloride;benzylviologenchloride;1,1'-DIBENZYL-4,4'-BIPYRIDINIUM DICHLORIDE SALT;n,n’-dibenzyl-gamma,gamma’-dipyridyliumdichloride;BENZYL VIOLOGEN DICHLORIDE 97% | | CAS: | 1102-19-8 | | MF: | C24H22Cl2N2 | | MW: | 409.35 | | EINECS: | 214-158-5 | | Product Categories: | Functional Materials;Photochromic Compounds;Pyridinium Compounds;Viologens (Photochromic, Related Compounds) | | Mol File: | 1102-19-8.mol |  |
| | 1,1'-Dibenzyl-4,4'-bipyridinium dichloride Chemical Properties |
| Melting point | 262 °C (dec.) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Soluble in water | | form | Solid | | color | White to off-white | | BRN | 3811585 | | InChI | InChI=1S/C24H22N2.2ClH/c1-3-7-21(8-4-1)19-25-15-11-23(12-16-25)24-13-17-26(18-14-24)20-22-9-5-2-6-10-22;;/h1-18H,19-20H2;2*1H/q+2;;/p-2 | | InChIKey | NLOIIDFMYPFJKP-UHFFFAOYSA-L | | SMILES | C1(C=C[N+](CC2C=CC=CC=2)=CC=1)C1C=C[N+](CC2C=CC=CC=2)=CC=1.[Cl-].[Cl-] | | CAS DataBase Reference | 1102-19-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | DW1930000 | | F | 3-10 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| | 1,1'-Dibenzyl-4,4'-bipyridinium dichloride Usage And Synthesis |
| Uses | BVD can be reduced to its neutral state by using sodium borohydride, which forms an n-type dopant for organic semiconductor based applications. It may be introduced to form a path for the transport of electrons from the thylakoid membranes to the mediator, which can be used in the fabrication of photo-driven bioanode. It also acts as a dopant with 2D layered materials to form an n-type chemical dopant that can be used to enhance the electrical properties of the triboelectric devices. | | General Description | Benzyl viologen dichloride (BVD) is an electrochromic indicator, which contains two chlorine atoms and an organic constituent attached with two nitrogen cations. In a redox reaction, BVD can be reduced in three states with different colors. |
| | 1,1'-Dibenzyl-4,4'-bipyridinium dichloride Preparation Products And Raw materials |
|