| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
BDP TMR carboxylic acid manufacturers
|
| | BDP TMR carboxylic acid Basic information |
| Product Name: | BDP TMR carboxylic acid | | Synonyms: | BDP TMR carboxylic acid;BODIPY TMR carboxylic acid;BDP TMR carboxylic acid/COOH;BDP TMR acid;3-(5,5-Difluoro-7-(4-methoxyphenyl)-1,3-dimethyl-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-2-yl)propanoic acid | | CAS: | 287384-28-5 | | MF: | C21H21BF2N2O3 | | MW: | 398.22 | | EINECS: | | | Product Categories: | | | Mol File: | 287384-28-5.mol |  |
| | BDP TMR carboxylic acid Chemical Properties |
| solubility | Soluble in alcohols, DMSO, DMF | | Appearance | Dark brown solid | | ex/em | 545/570 nm | | ε(extinction coefficient) | 55000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.64 | | InChI | InChI=1S/C21H21BF2N2O3/c1-13-18(9-11-21(27)28)14(2)25-20(13)12-16-6-10-19(26(16)22(25,23)24)15-4-7-17(29-3)8-5-15/h4-8,10,12H,9,11H2,1-3H3,(H,27,28) | | InChIKey | XNXZTGCQHQKUMJ-UHFFFAOYSA-N | | SMILES | [F-][B+3]1([N-]2C(=C(CCC(=O)[O-])C(C)=C2C=C2C=CC(C3C=CC(OC)=CC=3)=N12)C)[F-].[H+] |
| | BDP TMR carboxylic acid Usage And Synthesis |
| Description | BDP TMR carboxylic acid is a BDP TR linker with a carboxylic acid. The BDP TMR dye is popular for the microscopy and fluorescence polarization assays. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | Appearance: Dark brown solid
ex/em: 545/570 nm
Extinction coefficient (ε): 55000 Lmol1cm1
Quantum yield (Φ): 0.64 | | Uses | BDP TMR carboxylic acid is a BDP TMR labeled carboxylic acid. BDP TMR carboxylic acid has the fluorophore BDP and can be used for oligonucleotide labeling and amino acid sequencing[1]. | | References | [1] Jian Zhou, et al. Single-molecule photoreaction quantitation through intraparticle-surface energy transfer (i-SET) spectroscopy. Nat Commun. 2020 Aug 27;11(1):4297. DOI:10.1038/s41467-020-18223-z | | Abs/Em Maxima | 542/574 nm | | Fluoresene quantum yield | 0.64 | | Extinction Coefficient | 55000 | | CF260 | 0.16 | | CF280 | 0.16 |
| | BDP TMR carboxylic acid Preparation Products And Raw materials |
|