| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
|
| | Diisopropyl (ethoxycarbonylmethyl)phosphonate Basic information |
| | Diisopropyl (ethoxycarbonylmethyl)phosphonate Chemical Properties |
| Boiling point | 142-143 °C11 mm Hg(lit.) | | density | 1.06 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.427(lit.) | | Fp | >230 °F | | form | liquid | | InChI | 1S/C10H21O5P/c1-6-13-10(11)7-16(12,14-8(2)3)15-9(4)5/h8-9H,6-7H2,1-5H3 | | InChIKey | YZEWJYIDAAGEHA-UHFFFAOYSA-N | | SMILES | CCOC(=O)CP(=O)(OC(C)C)OC(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Diisopropyl (ethoxycarbonylmethyl)phosphonate Usage And Synthesis |
| Uses | Reactant for:
- Preparation of spiroimine ring fragment of spirolides via stereoselective intermolecular Diels-Alder and aza-Wittig cyclization
- Katsuki-Sharpless epoxidation reaction
- Preparation of nine-membered diallylic sulfonamides as chiral building blocks
- Alpha-phosphono lactams for subsequent Wadsworth-Emmons olefination, and Suzuki coupling reactions to yield diverse pyrrolidinone compounds
- Synthesis of galactosylceramide analog that induces Th1-biased responses in human (NKT) cells
- Stereoselective total synthesis of the ionophore antibiotic zincophorin (M144255)
| | reaction suitability | reaction type: C-C Bond Formation |
| | Diisopropyl (ethoxycarbonylmethyl)phosphonate Preparation Products And Raw materials |
|