| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 10-Methylanthracene-9-carboxaldehyde Basic information |
| | 10-Methylanthracene-9-carboxaldehyde Chemical Properties |
| Melting point | 169-171.5 °C (lit.) | | Boiling point | 321.21°C (rough estimate) | | density | 1.0588 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C16H12O/c1-11-12-6-2-4-8-14(12)16(10-17)15-9-5-3-7-13(11)15/h2-10H,1H3 | | InChIKey | KVWSVUPNZVIFBN-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1c2ccccc2c(C)c3ccccc13 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 10-Methylanthracene-9-carboxaldehyde Usage And Synthesis |
| Chemical Properties | yellow crystalline powder or needles |
| | 10-Methylanthracene-9-carboxaldehyde Preparation Products And Raw materials |
|