| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine Basic information |
| Product Name: | 2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine | | Synonyms: | 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine;2-CHLORO-4-ETHYLAMINO-15N-6-ISOPROPYL-AM INO-1,3,5-TRIAZINE, 99 ATOM % 15N;atrazine-ethylamino-15n1;2-Chloro-4-ethylamino-1?N-6-isopropylamino-1,3,5-triazine;2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine;2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine | | CAS: | 287476-17-9 | | MF: | C8H14ClN5 | | MW: | 216.69 | | EINECS: | 621-566-0 | | Product Categories: | | | Mol File: | 287476-17-9.mol |  |
| | 2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine Chemical Properties |
| Melting point | 172-174 °C (lit.) | | Major Application | environmental | | InChI | 1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14)/i10+1 | | InChIKey | MXWJVTOOROXGIU-DETAZLGJSA-N | | SMILES | CC[15NH]c1nc(Cl)nc(NC(C)C)n1 |
| Hazard Codes | Xn | | Risk Statements | 20/22-36/37/38-40-43 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1
STOT RE 2 Oral |
| | 2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine Usage And Synthesis |
| | 2-Chloro-4-ethylamino-15N-6-isopropylamino-1,3,5-triazine Preparation Products And Raw materials |
|