| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methoxyphenyl 4'-(3-butenyloxy)benzoate Basic information |
| Product Name: | 4-Methoxyphenyl 4'-(3-butenyloxy)benzoate | | Synonyms: | TIMTEC-BB SBB008451;4-METHOXYPHENYL 4''-(3-BUTENYLOXY)BENZOATE ---IN THE SYNTHESIS OF LIQUID CRYSTAL POLYSILOXANES---;4-(3-Butenyloxy)benzoic Acid 4-Methoxyphenyl Ester;4-Methoxyphenyl 4-(but-3-enyloxy)benzoate;4-Methoxyphenyl4-(3-Butenyloxy)benzoate>;Benzoic acid, 4-(3-buten-1-yloxy)-, 4-methoxyphenyl ester;(4-But-3-enyloxy)benzoic acid 4-methoxyphenyl ester;4-Methoxyphenyl 4-(3-buten-1-yloxy)benzoate | | CAS: | 76487-56-4 | | MF: | C18H18O4 | | MW: | 298.33 | | EINECS: | | | Product Categories: | | | Mol File: | 76487-56-4.mol |  |
| | 4-Methoxyphenyl 4'-(3-butenyloxy)benzoate Chemical Properties |
| Melting point | 79 °C | | Boiling point | 445.230±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.124±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C18H18O4/c1-3-4-13-21-16-7-5-14(6-8-16)18(19)22-17-11-9-15(20-2)10-12-17/h3,5-12H,1,4,13H2,2H3 | | InChIKey | CXPLNUIZUUBDCU-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(OC)C=C1)(=O)C1=CC=C(OCCC=C)C=C1 |
| | 4-Methoxyphenyl 4'-(3-butenyloxy)benzoate Usage And Synthesis |
| | 4-Methoxyphenyl 4'-(3-butenyloxy)benzoate Preparation Products And Raw materials |
|