| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-(3-Methoxypropylamino)pyrrolidine-1-carboxylic acid tert-butyl ester Basic information |
| | 3-(3-Methoxypropylamino)pyrrolidine-1-carboxylic acid tert-butyl ester Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C13H26N2O3/c1-13(2,3)18-12(16)15-8-6-11(10-15)14-7-5-9-17-4/h11,14H,5-10H2,1-4H3 | | InChIKey | VBSWFLDDFIIMGJ-UHFFFAOYSA-N | | SMILES | COCCCNC1CN(C(OC(C)(C)C)=O)CC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 3-(3-Methoxypropylamino)pyrrolidine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 3-(3-Methoxypropylamino)pyrrolidine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|