| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Quaterrylene Basic information |
| Product Name: | Quaterrylene | | Synonyms: | 4,5,6-c'd')diperylene;Benzo(1,2,3-cd;Benzo[10,5]anthra[9,1,2-cde]dibenzo[kl,rst]pentaphene;Benzo(1,2,3-cd:4,5,6-C'D')diperylene;Dibenzo[kl,rst]benzo[10,5]anthra[9,1,2-cde]pentaphene;Quaterrylene | | CAS: | 188-73-8 | | MF: | C40H20 | | MW: | 500.59 | | EINECS: | | | Product Categories: | | | Mol File: | 188-73-8.mol |  |
| | Quaterrylene Chemical Properties |
| density | 1.467±0.06 g/cm3 (lit.) | | form | powder | | InChIKey | BWASZFNXSFVOCT-UHFFFAOYSA-N | | SMILES | C12=CC=CC(C3=C(C4=CC=C5C6=CC=C(C7=CC=C8)C9=C(C%10=C7C8=CC=C%10)C=CC%11C96)C5=C%11C=C3)=C1C4=CC=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Quaterrylene Usage And Synthesis |
| Uses | A promising candidate for organic electronic applications because it absorbs a broad spectrum of UV and visible light, while possessing excellent thermal and oxidative stability and a low HOMO-LUMO band gap.
- Organic Electronics
- Photovoltaic Components
- Graphene Nanoribbons
- Electroactive Polymers
| | Definition | ChEBI: Quaterrylene is an ortho- and peri-fused polycyclic arene. |
| | Quaterrylene Preparation Products And Raw materials |
|