|
|
| | 4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride Basic information |
| Product Name: | 4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride | | Synonyms: | 4-[(4-CHLOROPHENYL) PHENYLMETHYL]-PIPERIDINE DIHYDROCHLORIDE;4-[(4-Chlorophenyl)phenylmethyl]-1-piperazine;4-(4-CHLOROPHENYL)PHENYLMETHYL-1-PIPERAZINEETHANOL 2HCL;4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride;1-(4-chloro Benzhydryl)-4-(2-hydroxyethyl)piperazine hydrochloride;1-(4-chloro Benzhydryl)-4-(2-hydroxyethyl)piperazine & sate of hcl;Levocetirizine Hydrochloride Impurity G DiHCl;Cetirizine Impurity G dihydrochloride | | CAS: | 164726-80-1 | | MF: | C19H25Cl3N2O | | MW: | 403.77 | | EINECS: | | | Product Categories: | Piperazines | | Mol File: | 164726-80-1.mol | ![4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride Structure](CAS/GIF/164726-80-1.gif) |
| | 4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride Chemical Properties |
| Melting point | >200°C (dec.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Methanol (Slightly), Water (Sparingly) | | form | Solid | | color | White | | Major Application | pharmaceutical | | InChI | 1S/C19H23ClN2O.2ClH/c20-18-8-6-17(7-9-18)19(16-4-2-1-3-5-16)22-12-10-21(11-13-22)14-15-23;;/h1-9,19,23H,10-15H2;2*1H | | InChIKey | GBVPOZKTNXLKST-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)C(N3CCN(CC3)CCO)c2ccccc2.Cl.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride Usage And Synthesis |
| Uses | 4-(p-Chloro-α-phenylbenzyl)-1-piperazineethanol is used in the synthesis of antifungal triazole and imidazole derivatives. Impurity of an intermediate in the formation of Cetrizine. |
| | 4-[(4-Chlorophenyl)phenylmethyl]-1-piperazineethanol dihydrochloride Preparation Products And Raw materials |
|