| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride manufacturers
- McN-A 343
-
- $79.00
-
2026-04-22
- CAS:55-45-8
- Purity: 99.82%
- Supply Ability: 10g
|
| | 4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride Basic information |
| Product Name: | 4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride | | Synonyms: | MCN A-343;(4-(m-chlorophenylcarbamoyloxy)-2-butynyl)trimethylammoniumchloride;4-((((3-chlorophenyl)amino)carbonyl)oxy)-n,n,n-trimethyl-butyl-1-aminiuc;a343;ammonium,(4-hydroxy-2-butynyl)trimethyl-,chloride,m-chlorocarbanilate;m-chloro-carbanilicaciesterwith(4-hydroxy-2-butynyl)trimethylammonium;mcna-343chloride;4-(N-(3-chlorophenyl)carbamoyloxy)-2-*butynyltrim | | CAS: | 55-45-8 | | MF: | C14H18Cl2N2O2 | | MW: | 317.21 | | EINECS: | | | Product Categories: | | | Mol File: | 55-45-8.mol | ![4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride Structure](CAS/GIF/55-45-8.gif) |
| | 4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride Chemical Properties |
| storage temp. | Desiccate at RT | | solubility | H2O: soluble | | form | powder | | color | white | | Water Solubility | Soluble to 100 mM in water | | InChI | 1S/C14H17ClN2O2.ClH/c1-17(2,3)9-4-5-10-19-14(18)16-13-8-6-7-12(15)11-13;/h6-8,11H,9-10H2,1-3H3;1H | | InChIKey | CXFZFEJJLNLOTA-UHFFFAOYSA-N | | SMILES | [Cl-].C[N+](C)(C)CC#CCOC(=O)Nc1cccc(Cl)c1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | BR0318000 | | Storage Class | 11 - Combustible Solids |
| | 4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride Usage And Synthesis |
| Uses | McN-A-343 is a selective agonist of mAChR M1. | | Biological Activity | Selective muscarinic M 1 receptor agonist. Selectivity for M 1 over other muscarinic receptor types appears to arise from a high efficacy at M 1 receptors. | | IC 50 | mAChR1 | | storage | Desiccate at RT |
| | 4-(N-[3-Chlorophenyl]-carbamoyloxy)-2-butynyltrimethylammonium chloride Preparation Products And Raw materials |
|