| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Nitromethanetrispropanol
CAS:116747-80-9
Purity:Nitromethanetrispropanol Package:5G Remarks:361534-5G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Nitromethanetrispropanol
CAS:116747-80-9
Purity:NULL Package:5g Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Nitromethanetrispropanol
CAS:116747-80-9
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:Nitromethanetrispropanol
CAS:116747-80-9
|
|
| | 4-(3-HYDROXYPROPYL)-4-NITRO-1,7-HEPTANEDIOL Basic information |
| Product Name: | 4-(3-HYDROXYPROPYL)-4-NITRO-1,7-HEPTANEDIOL | | Synonyms: | 4-(3-HYDROXYPROPYL)-4-NITRO-1,7-HEPTANEDIOL;3,3',3''-(Nitromethylidyne)tris(1-propanol);4-Nitro-4-(3-hydroxypropyl)heptane-1,7-diol;4-(3-hydroxypropyl)-4-nitroheptane-1,7-diol;1,7-Heptanediol, 4-(3-hydroxypropyl)-4-nitro-;NITROMETHANETRISPROPANOL | | CAS: | 116747-80-9 | | MF: | C10H21NO5 | | MW: | 235.28 | | EINECS: | | | Product Categories: | | | Mol File: | 116747-80-9.mol |  |
| | 4-(3-HYDROXYPROPYL)-4-NITRO-1,7-HEPTANEDIOL Chemical Properties |
| Melting point | 59-65 °C (lit.) | | InChI | 1S/C10H21NO5/c12-7-1-4-10(11(15)16,5-2-8-13)6-3-9-14/h12-14H,1-9H2 | | InChIKey | WQOWCQQAYGOQNI-UHFFFAOYSA-N | | SMILES | OCCCC(CCCO)(CCCO)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(3-HYDROXYPROPYL)-4-NITRO-1,7-HEPTANEDIOL Usage And Synthesis |
| | 4-(3-HYDROXYPROPYL)-4-NITRO-1,7-HEPTANEDIOL Preparation Products And Raw materials |
|