| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
FTI-276 manufacturers
- FTI 276
-
- $2580.00
-
2026-05-22
- CAS:170006-72-1
- Purity:
- Supply Ability: 10g
- FTI 276
-
- $2580.00
-
2026-05-21
- CAS:170006-72-1
- Purity:
- Supply Ability: 10g
- FTI 276
-
- $1820.00
-
2025-07-22
- CAS:170006-72-1
- Purity:
- Supply Ability: 10g
|
| | FTI-276 Basic information |
| Product Name: | FTI-276 | | Synonyms: | N-[4-[2-(R)-AMINO-3-MERCAPTOPROPYL]AMINO-2-PHENYLBENZOYL]METHIONINE TRIFLUOROACETATE SALT;N-[2-PHENYL-4-N[2(R)-AMINO-3-MERCAPTOPROPYLAMINO BENZOYL]-METHIONINE, TFA;FTI-276;FTI-276 trifluoroacetate salt;ZIXDDEATQSBHHL-BEFAXECRSA-N;L-Methionine, N-[[5-[[(2R)-2-amino-3-mercaptopropyl]amino][1,1'-biphenyl]-2-yl]carbonyl]- | | CAS: | 170006-72-1 | | MF: | C21H27N3O3S2 | | MW: | 433.59 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | FTI-276 Chemical Properties |
| Boiling point | 715.6±60.0 °C(Predicted) | | density | 1.272±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | H2O: >5 mg/mL, soluble | | form | solid | | pka | 3.54±0.10(Predicted) | | color | off-white | | Water Solubility | H2O: >5mg/mL | | InChIKey | IAVHISGQCODLHL-WSCVZUBPSA-N | | SMILES | OC(=O)C(F)(F)F.CSCC[C@H](NC(=O)c1ccc(NC[C@@H](N)CS)cc1-c2ccccc2)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FTI-276 Usage And Synthesis |
| Uses | N-[4-[2(R)-Amino-3-mercaptopropyl]amino-2-phenylbenzoyl]methionine Trifluoroacetate Salt is a useful intermediate. | | Definition | ChEBI: (2S)-2-[[[4-[[(2R)-2-amino-3-mercaptopropyl]amino]-2-phenylphenyl]-oxomethyl]amino]-4-(methylthio)butanoic acid is a methionine derivative. | | Biochem/physiol Actions | FTI-276 is a highly potent RasCAAX peptidomimetic. FTI-276 antagonizes both H and K-Ras oncogenic signaling. It is an inhibitor of farnesyltransferase (Ftase) in vitro with an IC50 of 500 pM and is an anti-cancer agent. |
| | FTI-276 Preparation Products And Raw materials |
|