| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
FTI-277 manufacturers
- FTI-277
-
- $1460.00
-
2026-05-11
- CAS:170006-73-2
- Purity: 99.63%
- Supply Ability: 10g
|
| | FTI-277 Basic information |
| Product Name: | FTI-277 | | Synonyms: | METHYL[N-[2-PHENYL-4-N-[2(R)-AMINO-3-MERCAPTOPROPYLAMINO] BENZOYL]]-METHIONATE, TFA;FTI-277;N-[4-[2(R)-AMINO-3-MERCAPTOPROPYL]AMINO-2-PHENYLBENZOYL]METHIONINE METHYL ESTER TRIFLUOROACETATE SALT;N-[4-[2(R)-Amino-3-mercaptopropyl]amino-2-phenylbenzoyl]methionine methyl ester trifluoroacetate salt;N-[[5-[[(2R)-2-Amino-3-mercaptopropyl]amino][1,1'-biphenyl]-2-yl]carbonyl]-L-methionine methyl ester;FTI-277;FTI277;L-Methionine, N-[[5-[[(2R)-2-amino-3-mercaptopropyl]amino][1,1'-biphenyl]-2-yl]carbonyl]-, methyl ester | | CAS: | 170006-73-2 | | MF: | C22H29N3O3S2 | | MW: | 447.61 | | EINECS: | | | Product Categories: | | | Mol File: | 170006-73-2.mol |  |
| | FTI-277 Chemical Properties |
| Boiling point | 684.2±55.0 °C(Predicted) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | H2O: soluble | | form | amorphous semi-solid | | pka | 9.81±0.10(Predicted) | | Water Solubility | H2O: ≥2mg/mL | | InChIKey | GJEFFRDWFVSCOJ-PXPMWPIZSA-N | | SMILES | OC(=O)C(F)(F)F.COC(=O)[C@H](CCSC)NC(=O)c1ccc(NC[C@@H](N)CS)cc1-c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FTI-277 Usage And Synthesis |
| Uses | Farnesyltransferase inhibitor 277 (FTI-277) has been used to:
- inhibit protein farnesylation in breast cell lines.
- in marrow-isolated adult multilineage inducible cells (MIAMI).
- inhibition of farnesyl transferase in CV-1 in Origin with SV40 genes cells (COS-7).
| | Biochem/physiol Actions | Farnesyltransferase inhibitor 277 (FTI-277) mediates apoptosis in multiple myeloma and is regarded as a potential therapeutic agent. |
| | FTI-277 Preparation Products And Raw materials |
|