|
|
| | 3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine Basic information |
| Product Name: | 3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine | | Synonyms: | AKOS BAR-0142;3'-TRIFLUOROMETHYLBIPHENYL-4-YLAMINE;3TRIFLUOROMETHYL4AMINOBIPHENYL;4-[3-(Trifluoromethyl)phenyl]aniline;3’-(Trifluoromethyl)-[1,1’-biphenyl]-4-amine;3′-(Trifluoromethyl)biphenyl-4-amine;3′-(trifluoromethyl)-1,1′-biphenyl-4-amine, CAS 397-28-4;3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine | | CAS: | 397-28-4 | | MF: | C13H10F3N | | MW: | 237.22 | | EINECS: | | | Product Categories: | | | Mol File: | 397-28-4.mol | ![3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine Structure](CAS/GIF/397-28-4.gif) |
| | 3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine Chemical Properties |
| form | solid | | InChI | 1S/C13H10F3N/c14-13(15,16)11-3-1-2-10(8-11)9-4-6-12(17)7-5-9/h1-8H,17H2 | | InChIKey | XREKLJQACWAWSV-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=CC=CC(C2=CC=C(N)C=C2)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine Usage And Synthesis |
| | 3'-(Trifluoromethyl)[1,1'-biphenyl]-4-amine Preparation Products And Raw materials |
|