3-Bromo-5-methoxy (1H)indazole manufacturers
|
| | 3-Bromo-5-methoxy (1H)indazole Basic information |
| | 3-Bromo-5-methoxy (1H)indazole Chemical Properties |
| Melting point | 178 °C | | Boiling point | 370.3±22.0 °C(Predicted) | | density | 1.678±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 11.43±0.40(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C8H7BrN2O/c1-12-5-2-3-7-6(4-5)8(9)11-10-7/h2-4H,1H3,(H,10,11) | | InChIKey | HYFXBJKOXIFDNQ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C(Br)=N1 |
| | 3-Bromo-5-methoxy (1H)indazole Usage And Synthesis |
| Chemical Properties | Yellow solid |
| | 3-Bromo-5-methoxy (1H)indazole Preparation Products And Raw materials |
|