|
|
| | 2-(Perfluorodecyl)ethyl acrylate Basic information |
| Product Name: | 2-(Perfluorodecyl)ethyl acrylate | | Synonyms: | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-HENEICOSAFLUORODODECYL ACRYLATE;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl acrylate;2-(PERFLUORODECYL)ETHYL ACRYLATE;1H,1H,2H,2H-PERFLUORODODECYL ACRYLATE;heineicosafluorododecyl acrylate;1,1,2,2-Tetrahydroperfluorododecylacrylate;2-Propenoicacid,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecylester;orododecylester | | CAS: | 17741-60-5 | | MF: | C15H7F21O2 | | MW: | 618.18 | | EINECS: | 241-732-2 | | Product Categories: | monomer;Acrylic Monomers;C12 to C63Monomers;Carbonyl Compounds;Esters;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers;Acrylic Monomers;Building Blocks;C12 to C63;Carbonyl Compounds;Chemical Synthesis;Contact Printing;Fluorinated Acrylics;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers;Materials Science;Micro/NanoElectronics;Monomers;Organic Building Blocks;Polymer Science;Self Assembly & | | Mol File: | 17741-60-5.mol |  |
| | 2-(Perfluorodecyl)ethyl acrylate Chemical Properties |
| Melting point | 48-53 °C(lit.) | | Boiling point | 122 °C4 mm Hg(lit.) | | density | 1.32 g/mL at 25 °C(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White | | Stability: | Light Sensitive | | InChI | InChI=1S/C15H7F21O2/c1-2-5(37)38-4-3-6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)36/h2H,1,3-4H2 | | InChIKey | FIAHOPQKBBASOY-UHFFFAOYSA-N | | SMILES | C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(=O)C=C | | CAS DataBase Reference | 17741-60-5(CAS DataBase Reference) | | EPA Substance Registry System | 1,1,2,2-Tetrahydroperfluorododecyl acrylate (17741-60-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-45 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2916120090 |
| | 2-(Perfluorodecyl)ethyl acrylate Usage And Synthesis |
| Uses | 2-?(Perfluorodecyl)?ethyl Acrylate is used as a reagent in the preparation of repellent finishes on cotton. |
| | 2-(Perfluorodecyl)ethyl acrylate Preparation Products And Raw materials |
|